About N-(cyclopropylmethyl)-2,6-difluoro-N-propylbenzenesulfonamide
N-(cyclopropylmethyl)-2,6-difluoro-N-propylbenzenesulfonamide (PubChem CID 78787052) has the molecular formula C13H17F2NO2S
and a molecular weight of 289.35 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2,6-difluoro-N-propylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-(cyclopropylmethyl)-2,6-difluoro-N-propylbenzenesulfonamide |
| PubChem CID | 78787052 |
| Molecular Formula | C13H17F2NO2S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-(cyclopropylmethyl)-2,6-difluoro-N-propylbenzenesulfonamide |
| SMILES | CCCN(CC1CC1)S(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C13H17F2NO2S/c1-2-8-16(9-10-6-7-10)19(17,18)13-11(14)4-3-5-12(13)15/h3-5,10H,2,6-9H2,1H3 |
| InChIKey | HIBSGHLADAOUES-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(cyclopropylmethyl)-2,6-difluoro-N-propylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylmethyl)-2,6-difluoro-N-propylbenzenesulfonamide?
The IUPAC name of N-(cyclopropylmethyl)-2,6-difluoro-N-propylbenzenesulfonamide (CID 78787052) is N-(cyclopropylmethyl)-2,6-difluoro-N-propylbenzenesulfonamide.
What is the SMILES notation for N-(cyclopropylmethyl)-2,6-difluoro-N-propylbenzenesulfonamide?
The canonical SMILES for N-(cyclopropylmethyl)-2,6-difluoro-N-propylbenzenesulfonamide is CCCN(CC1CC1)S(=O)(=O)c1c(F)cccc1F.
What is the InChIKey of N-(cyclopropylmethyl)-2,6-difluoro-N-propylbenzenesulfonamide?
The InChIKey is HIBSGHLADAOUES-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F2NO2S/c1-2-8-16(9-10-6-7-10)19(17,18)13-11(14)4-3-5-12(13)15/h3-5,10H,2,6-9H2,1H3.
What are the key properties of N-(cyclopropylmethyl)-2,6-difluoro-N-propylbenzenesulfonamide?
N-(cyclopropylmethyl)-2,6-difluoro-N-propylbenzenesulfonamide has a molecular weight of 289.35 g/mol, XLogP of 2.78, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)-2,6-difluoro-N-propylbenzenesulfonamide is sourced from PubChem (CID 78787052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).