C14H20ClN3O — CID 78787390
2-[4-(3-chlorophenyl)piperazin-1-yl]-N,N-dimethylacetamide (PubChem CID 78787390) has the molecular formula C14H20ClN3O and a molecular weight of 281.79 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)piperazin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 78787390 |
| Molecular Formula | C14H20ClN3O |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C14H20ClN3O/c1-16(2)14(19)11-17-6-8-18(9-7-17)13-5-3-4-12(15)10-13/h3-5,10H,6-9,11H2,1-2H3 |
| InChIKey | UEZAEZSIPWQWTA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |