C16H24ClN3O3S — CID 78787610
2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-N,N-diethylacetamide (PubChem CID 78787610) has the molecular formula C16H24ClN3O3S and a molecular weight of 373.91 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 78787610 |
| Molecular Formula | C16H24ClN3O3S |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H24ClN3O3S/c1-3-19(4-2)16(21)13-18-9-11-20(12-10-18)24(22,23)15-7-5-14(17)6-8-15/h5-8H,3-4,9-13H2,1-2H3 |
| InChIKey | AJIMVVKRXXNFIT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |