C21H23N3O5 — CID 7878859
(2-oxo-2-piperidin-1-ylethyl) 2-(benzylamino)-5-nitrobenzoate (PubChem CID 7878859) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 2-(benzylamino)-5-nitrobenzoate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 2-(benzylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 7878859 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 2-(benzylamino)-5-nitrobenzoate |
| SMILES | O=C(OCC(=O)N1CCCCC1)c1cc([N+](=O)[O-])ccc1NCc1ccccc1 |
| InChI | InChI=1S/C21H23N3O5/c25-20(23-11-5-2-6-12-23)15-29-21(26)18-13-17(24(27)28)9-10-19(18)22-14-16-7-3-1-4-8-16/h1,3-4,7-10,13,22H,2,5-6,11-12,14-15H2 |
| InChIKey | BHMHWEUXMQPAGJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|