About N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-2,2-diphenylacetamide
N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-2,2-diphenylacetamide (PubChem CID 787894) has the molecular formula C21H21N3O2
and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-2,2-diphenylacetamide |
| PubChem CID | 787894 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-2,2-diphenylacetamide |
| SMILES | Cc1cc(C)n(C(=O)CNC(=O)C(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C21H21N3O2/c1-15-13-16(2)24(23-15)19(25)14-22-21(26)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-13,20H,14H2,1-2H3,(H,22,26) |
| InChIKey | GJKZWVSQAXDQAO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-2,2-diphenylacetamide?
The IUPAC name of N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-2,2-diphenylacetamide (CID 787894) is N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-2,2-diphenylacetamide.
What is the SMILES notation for N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-2,2-diphenylacetamide?
The canonical SMILES for N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-2,2-diphenylacetamide is Cc1cc(C)n(C(=O)CNC(=O)C(c2ccccc2)c2ccccc2)n1.
What is the InChIKey of N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-2,2-diphenylacetamide?
The InChIKey is GJKZWVSQAXDQAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O2/c1-15-13-16(2)24(23-15)19(25)14-22-21(26)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-13,20H,14H2,1-2H3,(H,22,26).
What are the key properties of N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-2,2-diphenylacetamide?
N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-2,2-diphenylacetamide has a molecular weight of 347.42 g/mol, XLogP of 3.09, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-2,2-diphenylacetamide is sourced from PubChem (CID 787894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).