C12H7Cl6NO2 — CID 78789632
1,7,8,9,10,10-hexachloro-4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 78789632) has the molecular formula C12H7Cl6NO2 and a molecular weight of 409.91 g/mol. Its IUPAC name is 1,7,8,9,10,10-hexachloro-4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 1,7,8,9,10,10-hexachloro-4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 78789632 |
| Molecular Formula | C12H7Cl6NO2 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 406.86 |
| IUPAC Name | 1,7,8,9,10,10-hexachloro-4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | C=CCN1C(=O)C2C(C1=O)C1(Cl)C(Cl)=C(Cl)C2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C12H7Cl6NO2/c1-2-3-19-8(20)4-5(9(19)21)11(16)7(14)6(13)10(4,15)12(11,17)18/h2,4-5H,1,3H2 |
| InChIKey | VZBSRSFWANBSKW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|