About 4-(4,5-dichloro-6-oxopyridazin-1-yl)butanenitrile
4-(4,5-dichloro-6-oxopyridazin-1-yl)butanenitrile (PubChem CID 78789888) has the molecular formula C8H7Cl2N3O
and a molecular weight of 232.07 g/mol. Its IUPAC name is 4-(4,5-dichloro-6-oxopyridazin-1-yl)butanenitrile.
Molecular Properties
| Compound Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)butanenitrile |
| PubChem CID | 78789888 |
| Molecular Formula | C8H7Cl2N3O |
| Molecular Weight | 232.07 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)butanenitrile |
| SMILES | N#CCCCn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C8H7Cl2N3O/c9-6-5-12-13(4-2-1-3-11)8(14)7(6)10/h5H,1-2,4H2 |
| InChIKey | MMAQRIHFKQDFNH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.07 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,5-dichloro-6-oxopyridazin-1-yl)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dichloro-6-oxopyridazin-1-yl)butanenitrile?
The IUPAC name of 4-(4,5-dichloro-6-oxopyridazin-1-yl)butanenitrile (CID 78789888) is 4-(4,5-dichloro-6-oxopyridazin-1-yl)butanenitrile.
What is the SMILES notation for 4-(4,5-dichloro-6-oxopyridazin-1-yl)butanenitrile?
The canonical SMILES for 4-(4,5-dichloro-6-oxopyridazin-1-yl)butanenitrile is N#CCCCn1ncc(Cl)c(Cl)c1=O.
What is the InChIKey of 4-(4,5-dichloro-6-oxopyridazin-1-yl)butanenitrile?
The InChIKey is MMAQRIHFKQDFNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl2N3O/c9-6-5-12-13(4-2-1-3-11)8(14)7(6)10/h5H,1-2,4H2.
What are the key properties of 4-(4,5-dichloro-6-oxopyridazin-1-yl)butanenitrile?
4-(4,5-dichloro-6-oxopyridazin-1-yl)butanenitrile has a molecular weight of 232.07 g/mol, XLogP of 1.85, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dichloro-6-oxopyridazin-1-yl)butanenitrile is sourced from PubChem (CID 78789888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).