About 1-[4-(2,2-difluoroacetyl)piperazin-1-yl]-2,2-difluoroethanone
1-[4-(2,2-difluoroacetyl)piperazin-1-yl]-2,2-difluoroethanone (PubChem CID 787902) has the molecular formula C8H10F4N2O2
and a molecular weight of 242.17 g/mol. Its IUPAC name is 1-[4-(2,2-difluoroacetyl)piperazin-1-yl]-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 1-[4-(2,2-difluoroacetyl)piperazin-1-yl]-2,2-difluoroethanone |
| PubChem CID | 787902 |
| Molecular Formula | C8H10F4N2O2 |
| Molecular Weight | 242.17 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 1-[4-(2,2-difluoroacetyl)piperazin-1-yl]-2,2-difluoroethanone |
| SMILES | O=C(C(F)F)N1CCN(C(=O)C(F)F)CC1 |
| InChI | InChI=1S/C8H10F4N2O2/c9-5(10)7(15)13-1-2-14(4-3-13)8(16)6(11)12/h5-6H,1-4H2 |
| InChIKey | UIMPEUKYJDMHCT-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.17 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-(2,2-difluoroacetyl)piperazin-1-yl]-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,2-difluoroacetyl)piperazin-1-yl]-2,2-difluoroethanone?
The IUPAC name of 1-[4-(2,2-difluoroacetyl)piperazin-1-yl]-2,2-difluoroethanone (CID 787902) is 1-[4-(2,2-difluoroacetyl)piperazin-1-yl]-2,2-difluoroethanone.
What is the SMILES notation for 1-[4-(2,2-difluoroacetyl)piperazin-1-yl]-2,2-difluoroethanone?
The canonical SMILES for 1-[4-(2,2-difluoroacetyl)piperazin-1-yl]-2,2-difluoroethanone is O=C(C(F)F)N1CCN(C(=O)C(F)F)CC1.
What is the InChIKey of 1-[4-(2,2-difluoroacetyl)piperazin-1-yl]-2,2-difluoroethanone?
The InChIKey is UIMPEUKYJDMHCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F4N2O2/c9-5(10)7(15)13-1-2-14(4-3-13)8(16)6(11)12/h5-6H,1-4H2.
What are the key properties of 1-[4-(2,2-difluoroacetyl)piperazin-1-yl]-2,2-difluoroethanone?
1-[4-(2,2-difluoroacetyl)piperazin-1-yl]-2,2-difluoroethanone has a molecular weight of 242.17 g/mol, XLogP of 0.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,2-difluoroacetyl)piperazin-1-yl]-2,2-difluoroethanone is sourced from PubChem (CID 787902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).