C13H18O3S — CID 78790264
2-ethoxyethyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate (PubChem CID 78790264) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is 2-ethoxyethyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate.
| Compound Name | 2-ethoxyethyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 78790264 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 2-ethoxyethyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
| SMILES | CCOCCOC(=O)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C13H18O3S/c1-2-15-7-8-16-13(14)12-9-10-5-3-4-6-11(10)17-12/h9H,2-8H2,1H3 |
| InChIKey | QVSNKJPTIZXLSN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|