2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate

C7H10Cl2O2S — CID 78790602

IUPAC2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate
SMILESCSCCOC(=O)C1CC1(Cl)Cl
InChIInChI=1S/C7H10Cl2O2S/c1-12-3-2-11-6(10)5-4-7(5,8)9/h5H,2-4H2,1H3
InChIKeyBUXZGMKDWHGXTP-UHFFFAOYSA-N
MW229.13 g/mol
LogP2.09
Rot. Bonds4

About 2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate

2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate (PubChem CID 78790602) has the molecular formula C7H10Cl2O2S and a molecular weight of 229.13 g/mol. Its IUPAC name is 2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate.

Molecular Properties

Compound Name2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate
PubChem CID78790602
Molecular FormulaC7H10Cl2O2S
Molecular Weight229.13 g/mol
Exact Mass227.98
IUPAC Name2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate
SMILESCSCCOC(=O)C1CC1(Cl)Cl
InChIInChI=1S/C7H10Cl2O2S/c1-12-3-2-11-6(10)5-4-7(5,8)9/h5H,2-4H2,1H3
InChIKeyBUXZGMKDWHGXTP-UHFFFAOYSA-N
XLogP2.09
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.13
LogP ≤ 52.09
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate?
The IUPAC name of 2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate (CID 78790602) is 2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate.
What is the SMILES notation for 2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate?
The canonical SMILES for 2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate is CSCCOC(=O)C1CC1(Cl)Cl.
What is the InChIKey of 2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate?
The InChIKey is BUXZGMKDWHGXTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10Cl2O2S/c1-12-3-2-11-6(10)5-4-7(5,8)9/h5H,2-4H2,1H3.
What are the key properties of 2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate?
2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate has a molecular weight of 229.13 g/mol, XLogP of 2.09, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylethyl 2,2-dichlorocyclopropane-1-carboxylate is sourced from PubChem (CID 78790602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).