About (4-ethoxy-3-methoxyphenyl)methyl 2-methylpentanoate
(4-ethoxy-3-methoxyphenyl)methyl 2-methylpentanoate (PubChem CID 78790842) has the molecular formula C16H24O4
and a molecular weight of 280.36 g/mol. Its IUPAC name is (4-ethoxy-3-methoxyphenyl)methyl 2-methylpentanoate.
Molecular Properties
| Compound Name | (4-ethoxy-3-methoxyphenyl)methyl 2-methylpentanoate |
| PubChem CID | 78790842 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (4-ethoxy-3-methoxyphenyl)methyl 2-methylpentanoate |
| SMILES | CCCC(C)C(=O)OCc1ccc(OCC)c(OC)c1 |
| InChI | InChI=1S/C16H24O4/c1-5-7-12(3)16(17)20-11-13-8-9-14(19-6-2)15(10-13)18-4/h8-10,12H,5-7,11H2,1-4H3 |
| InChIKey | VWPCHCYPPUFKQK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-ethoxy-3-methoxyphenyl)methyl 2-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxy-3-methoxyphenyl)methyl 2-methylpentanoate?
The IUPAC name of (4-ethoxy-3-methoxyphenyl)methyl 2-methylpentanoate (CID 78790842) is (4-ethoxy-3-methoxyphenyl)methyl 2-methylpentanoate.
What is the SMILES notation for (4-ethoxy-3-methoxyphenyl)methyl 2-methylpentanoate?
The canonical SMILES for (4-ethoxy-3-methoxyphenyl)methyl 2-methylpentanoate is CCCC(C)C(=O)OCc1ccc(OCC)c(OC)c1.
What is the InChIKey of (4-ethoxy-3-methoxyphenyl)methyl 2-methylpentanoate?
The InChIKey is VWPCHCYPPUFKQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O4/c1-5-7-12(3)16(17)20-11-13-8-9-14(19-6-2)15(10-13)18-4/h8-10,12H,5-7,11H2,1-4H3.
What are the key properties of (4-ethoxy-3-methoxyphenyl)methyl 2-methylpentanoate?
(4-ethoxy-3-methoxyphenyl)methyl 2-methylpentanoate has a molecular weight of 280.36 g/mol, XLogP of 3.57, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxy-3-methoxyphenyl)methyl 2-methylpentanoate is sourced from PubChem (CID 78790842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).