C9H11NOS — CID 787914
N-(5,6,7,8-tetrahydrocyclohepta[b]thiophen-4-ylidene)hydroxylamine (PubChem CID 787914) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is N-(5,6,7,8-tetrahydrocyclohepta[b]thiophen-4-ylidene)hydroxylamine.
| Compound Name | N-(5,6,7,8-tetrahydrocyclohepta[b]thiophen-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 787914 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | N-(5,6,7,8-tetrahydrocyclohepta[b]thiophen-4-ylidene)hydroxylamine |
| SMILES | ON=C1CCCCc2sccc21 |
| InChI | InChI=1S/C9H11NOS/c11-10-8-3-1-2-4-9-7(8)5-6-12-9/h5-6,11H,1-4H2 |
| InChIKey | IXIDLXSEAAKLNE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|