C21H22N4O3 — CID 78791485
2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[phenyl(pyridin-2-yl)methyl]acetamide (PubChem CID 78791485) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[phenyl(pyridin-2-yl)methyl]acetamide.
| Compound Name | 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[phenyl(pyridin-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 78791485 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[phenyl(pyridin-2-yl)methyl]acetamide |
| SMILES | CC1(C2CC2)NC(=O)N(CC(=O)NC(c2ccccc2)c2ccccn2)C1=O |
| InChI | InChI=1S/C21H22N4O3/c1-21(15-10-11-15)19(27)25(20(28)24-21)13-17(26)23-18(14-7-3-2-4-8-14)16-9-5-6-12-22-16/h2-9,12,15,18H,10-11,13H2,1H3,(H,23,26)(H,24,28) |
| InChIKey | QKJMCVAYQAWILT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|