C22H30N4O3 — CID 78791899
propan-2-yl 2,4-dimethyl-5-[[4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]-1H-pyrrole-3-carboxylate (PubChem CID 78791899) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is propan-2-yl 2,4-dimethyl-5-[[4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]-1H-pyrrole-3-carboxylate.
| Compound Name | propan-2-yl 2,4-dimethyl-5-[[4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 78791899 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | propan-2-yl 2,4-dimethyl-5-[[4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]-1H-pyrrole-3-carboxylate |
| SMILES | Cc1[nH]c(C(=O)Nc2ccc(N3CCN(C)CC3)cc2)c(C)c1C(=O)OC(C)C |
| InChI | InChI=1S/C22H30N4O3/c1-14(2)29-22(28)19-15(3)20(23-16(19)4)21(27)24-17-6-8-18(9-7-17)26-12-10-25(5)11-13-26/h6-9,14,23H,10-13H2,1-5H3,(H,24,27) |
| InChIKey | FQKATYCPXUEWLV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|