C13H17NO3 — CID 78792072
2-(5-acetyl-2-methoxyphenyl)-N,N-dimethylacetamide (PubChem CID 78792072) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-(5-acetyl-2-methoxyphenyl)-N,N-dimethylacetamide.
| Compound Name | 2-(5-acetyl-2-methoxyphenyl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 78792072 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-(5-acetyl-2-methoxyphenyl)-N,N-dimethylacetamide |
| SMILES | COc1ccc(C(C)=O)cc1CC(=O)N(C)C |
| InChI | InChI=1S/C13H17NO3/c1-9(15)10-5-6-12(17-4)11(7-10)8-13(16)14(2)3/h5-7H,8H2,1-4H3 |
| InChIKey | DYFINACXPRWNTH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |