C19H18N2O3S2 — CID 78792257
N-[4-methyl-3-(methylsulfamoyl)phenyl]-3-phenylthiophene-2-carboxamide (PubChem CID 78792257) has the molecular formula C19H18N2O3S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[4-methyl-3-(methylsulfamoyl)phenyl]-3-phenylthiophene-2-carboxamide.
| Compound Name | N-[4-methyl-3-(methylsulfamoyl)phenyl]-3-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 78792257 |
| Molecular Formula | C19H18N2O3S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-[4-methyl-3-(methylsulfamoyl)phenyl]-3-phenylthiophene-2-carboxamide |
| SMILES | CNS(=O)(=O)c1cc(NC(=O)c2sccc2-c2ccccc2)ccc1C |
| InChI | InChI=1S/C19H18N2O3S2/c1-13-8-9-15(12-17(13)26(23,24)20-2)21-19(22)18-16(10-11-25-18)14-6-4-3-5-7-14/h3-12,20H,1-2H3,(H,21,22) |
| InChIKey | VYJBIHXVKAPCPH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |