C23H18N4O3 — CID 78793445
5-[(7-methyl-2-oxochromen-4-yl)methyl]-1-(2-methylphenyl)pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 78793445) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is 5-[(7-methyl-2-oxochromen-4-yl)methyl]-1-(2-methylphenyl)pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-[(7-methyl-2-oxochromen-4-yl)methyl]-1-(2-methylphenyl)pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 78793445 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 5-[(7-methyl-2-oxochromen-4-yl)methyl]-1-(2-methylphenyl)pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cc1ccc2c(Cn3cnc4c(cnn4-c4ccccc4C)c3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H18N4O3/c1-14-7-8-17-16(10-21(28)30-20(17)9-14)12-26-13-24-22-18(23(26)29)11-25-27(22)19-6-4-3-5-15(19)2/h3-11,13H,12H2,1-2H3 |
| InChIKey | OLUZLAXYFYGALZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 82.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|