C20H25NO4 — CID 78794099
N-[2-(4-methoxyphenoxy)ethyl]-3-(4-methoxyphenyl)-N-methylpropanamide (PubChem CID 78794099) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)ethyl]-3-(4-methoxyphenyl)-N-methylpropanamide.
| Compound Name | N-[2-(4-methoxyphenoxy)ethyl]-3-(4-methoxyphenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 78794099 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)ethyl]-3-(4-methoxyphenyl)-N-methylpropanamide |
| SMILES | COc1ccc(CCC(=O)N(C)CCOc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H25NO4/c1-21(14-15-25-19-11-9-18(24-3)10-12-19)20(22)13-6-16-4-7-17(23-2)8-5-16/h4-5,7-12H,6,13-15H2,1-3H3 |
| InChIKey | JQVLMTSOMDOGTG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |