C20H24N2O4S — CID 78795560
N-[4-[2,3-dihydro-1,4-benzodioxin-3-ylmethyl(ethyl)amino]-4-oxobutyl]thiophene-2-carboxamide (PubChem CID 78795560) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[4-[2,3-dihydro-1,4-benzodioxin-3-ylmethyl(ethyl)amino]-4-oxobutyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[2,3-dihydro-1,4-benzodioxin-3-ylmethyl(ethyl)amino]-4-oxobutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78795560 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-[4-[2,3-dihydro-1,4-benzodioxin-3-ylmethyl(ethyl)amino]-4-oxobutyl]thiophene-2-carboxamide |
| SMILES | CCN(CC1COc2ccccc2O1)C(=O)CCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C20H24N2O4S/c1-2-22(13-15-14-25-16-7-3-4-8-17(16)26-15)19(23)10-5-11-21-20(24)18-9-6-12-27-18/h3-4,6-9,12,15H,2,5,10-11,13-14H2,1H3,(H,21,24) |
| InChIKey | KUVVSRLRNVTIPL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|