C16H20N4O — CID 78795753
(4-methyl-1,4-diazepan-1-yl)-(3-phenylimidazol-4-yl)methanone (PubChem CID 78795753) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is (4-methyl-1,4-diazepan-1-yl)-(3-phenylimidazol-4-yl)methanone.
| Compound Name | (4-methyl-1,4-diazepan-1-yl)-(3-phenylimidazol-4-yl)methanone |
|---|---|
| PubChem CID | 78795753 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (4-methyl-1,4-diazepan-1-yl)-(3-phenylimidazol-4-yl)methanone |
| SMILES | CN1CCCN(C(=O)c2cncn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C16H20N4O/c1-18-8-5-9-19(11-10-18)16(21)15-12-17-13-20(15)14-6-3-2-4-7-14/h2-4,6-7,12-13H,5,8-11H2,1H3 |
| InChIKey | JQLRLTYNVGXODP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |