C19H21N3O2 — CID 78796237
N-(3-hydroxypropyl)-3-(1-phenylbenzimidazol-2-yl)propanamide (PubChem CID 78796237) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-3-(1-phenylbenzimidazol-2-yl)propanamide.
| Compound Name | N-(3-hydroxypropyl)-3-(1-phenylbenzimidazol-2-yl)propanamide |
|---|---|
| PubChem CID | 78796237 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-(3-hydroxypropyl)-3-(1-phenylbenzimidazol-2-yl)propanamide |
| SMILES | O=C(CCc1nc2ccccc2n1-c1ccccc1)NCCCO |
| InChI | InChI=1S/C19H21N3O2/c23-14-6-13-20-19(24)12-11-18-21-16-9-4-5-10-17(16)22(18)15-7-2-1-3-8-15/h1-5,7-10,23H,6,11-14H2,(H,20,24) |
| InChIKey | FWBUAVGYNCNXPR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|