C23H19N3O3 — CID 78796877
N-[2-(3,4-dihydroxyphenyl)ethyl]-2-pyridin-4-ylquinoline-4-carboxamide (PubChem CID 78796877) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-2-pyridin-4-ylquinoline-4-carboxamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2-pyridin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 78796877 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2-pyridin-4-ylquinoline-4-carboxamide |
| SMILES | O=C(NCCc1ccc(O)c(O)c1)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C23H19N3O3/c27-21-6-5-15(13-22(21)28)7-12-25-23(29)18-14-20(16-8-10-24-11-9-16)26-19-4-2-1-3-17(18)19/h1-6,8-11,13-14,27-28H,7,12H2,(H,25,29) |
| InChIKey | ZDCXXVZAAVLLIP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|