C17H20N2O4S — CID 78800316
N-(2-hydroxypropyl)-4-[(4-methylphenyl)sulfamoyl]benzamide (PubChem CID 78800316) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-4-[(4-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-(2-hydroxypropyl)-4-[(4-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 78800316 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-(2-hydroxypropyl)-4-[(4-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)NCC(C)O)cc2)cc1 |
| InChI | InChI=1S/C17H20N2O4S/c1-12-3-7-15(8-4-12)19-24(22,23)16-9-5-14(6-10-16)17(21)18-11-13(2)20/h3-10,13,19-20H,11H2,1-2H3,(H,18,21) |
| InChIKey | TZEIPVMOJNIJJA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |