C17H22N4OS — CID 78801247
2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(4-butan-2-ylphenyl)acetamide (PubChem CID 78801247) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(4-butan-2-ylphenyl)acetamide.
| Compound Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(4-butan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 78801247 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(4-butan-2-ylphenyl)acetamide |
| SMILES | CCC(C)c1ccc(NC(=O)CSc2nc(C)cc(N)n2)cc1 |
| InChI | InChI=1S/C17H22N4OS/c1-4-11(2)13-5-7-14(8-6-13)20-16(22)10-23-17-19-12(3)9-15(18)21-17/h5-9,11H,4,10H2,1-3H3,(H,20,22)(H2,18,19,21) |
| InChIKey | SBLVPMNDFRPFNG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |