C19H29N3 — CID 78804123
3-[4-[[(2,3-dimethylcyclohexyl)amino]methyl]-N-methylanilino]propanenitrile (PubChem CID 78804123) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 3-[4-[[(2,3-dimethylcyclohexyl)amino]methyl]-N-methylanilino]propanenitrile.
| Compound Name | 3-[4-[[(2,3-dimethylcyclohexyl)amino]methyl]-N-methylanilino]propanenitrile |
|---|---|
| PubChem CID | 78804123 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 3-[4-[[(2,3-dimethylcyclohexyl)amino]methyl]-N-methylanilino]propanenitrile |
| SMILES | CC1CCCC(NCc2ccc(N(C)CCC#N)cc2)C1C |
| InChI | InChI=1S/C19H29N3/c1-15-6-4-7-19(16(15)2)21-14-17-8-10-18(11-9-17)22(3)13-5-12-20/h8-11,15-16,19,21H,4-7,13-14H2,1-3H3 |
| InChIKey | LPYYBYCQLOQGMJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|