C21H20FN3O2S — CID 78804750
1-benzyl-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-6-oxopyridazine-3-carboxamide (PubChem CID 78804750) has the molecular formula C21H20FN3O2S and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-benzyl-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-benzyl-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 78804750 |
| Molecular Formula | C21H20FN3O2S |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 1-benzyl-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-6-oxopyridazine-3-carboxamide |
| SMILES | O=C(NCCSCc1ccccc1F)c1ccc(=O)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C21H20FN3O2S/c22-18-9-5-4-8-17(18)15-28-13-12-23-21(27)19-10-11-20(26)25(24-19)14-16-6-2-1-3-7-16/h1-11H,12-15H2,(H,23,27) |
| InChIKey | VRJQKDGTJJSDQH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|