C20H29N5O3 — CID 78807035
N-(2-cyclohexylpyrazol-3-yl)-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanamide (PubChem CID 78807035) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-(2-cyclohexylpyrazol-3-yl)-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanamide.
| Compound Name | N-(2-cyclohexylpyrazol-3-yl)-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanamide |
|---|---|
| PubChem CID | 78807035 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N-(2-cyclohexylpyrazol-3-yl)-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)NC2(CCCC2)C1=O)Nc1ccnn1C1CCCCC1 |
| InChI | InChI=1S/C20H29N5O3/c26-17(22-16-10-13-21-25(16)15-7-2-1-3-8-15)9-6-14-24-18(27)20(23-19(24)28)11-4-5-12-20/h10,13,15H,1-9,11-12,14H2,(H,22,26)(H,23,28) |
| InChIKey | RXGMPPXNWHYIKG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|