methyl (3S)-3-amino-3-phenylpropanoate

C10H13NO2 — CID 788099

IUPACmethyl (3S)-3-amino-3-phenylpropanoate
SMILESCOC(=O)C[C@H](N)c1ccccc1
InChIInChI=1S/C10H13NO2/c1-13-10(12)7-9(11)8-5-3-2-4-6-8/h2-6,9H,7,11H2,1H3/t9-/m0/s1
InChIKeyXKIOBYHZFPTKCZ-VIFPVBQESA-N
MW179.22 g/mol
LogP1.25
Rot. Bonds3

About methyl (3S)-3-amino-3-phenylpropanoate

methyl (3S)-3-amino-3-phenylpropanoate (PubChem CID 788099) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-phenylpropanoate.

Molecular Properties

Compound Namemethyl (3S)-3-amino-3-phenylpropanoate
PubChem CID788099
Molecular FormulaC10H13NO2
Molecular Weight179.22 g/mol
Exact Mass179.09
IUPAC Namemethyl (3S)-3-amino-3-phenylpropanoate
SMILESCOC(=O)C[C@H](N)c1ccccc1
InChIInChI=1S/C10H13NO2/c1-13-10(12)7-9(11)8-5-3-2-4-6-8/h2-6,9H,7,11H2,1H3/t9-/m0/s1
InChIKeyXKIOBYHZFPTKCZ-VIFPVBQESA-N
XLogP1.25
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.22
LogP ≤ 51.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl (3S)-3-amino-3-phenylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (3S)-3-amino-3-phenylpropanoate?
The IUPAC name of methyl (3S)-3-amino-3-phenylpropanoate (CID 788099) is methyl (3S)-3-amino-3-phenylpropanoate.
What is the SMILES notation for methyl (3S)-3-amino-3-phenylpropanoate?
The canonical SMILES for methyl (3S)-3-amino-3-phenylpropanoate is COC(=O)C[C@H](N)c1ccccc1.
What is the InChIKey of methyl (3S)-3-amino-3-phenylpropanoate?
The InChIKey is XKIOBYHZFPTKCZ-VIFPVBQESA-N. The full InChI is InChI=1S/C10H13NO2/c1-13-10(12)7-9(11)8-5-3-2-4-6-8/h2-6,9H,7,11H2,1H3/t9-/m0/s1.
What are the key properties of methyl (3S)-3-amino-3-phenylpropanoate?
methyl (3S)-3-amino-3-phenylpropanoate has a molecular weight of 179.22 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-3-amino-3-phenylpropanoate is sourced from PubChem (CID 788099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).