C23H29N3O3 — CID 78810432
3-acetamido-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-phenylpropanamide (PubChem CID 78810432) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 3-acetamido-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-phenylpropanamide.
| Compound Name | 3-acetamido-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 78810432 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 3-acetamido-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-phenylpropanamide |
| SMILES | CC(=O)NC(CC(=O)NCc1ccccc1CN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O3/c1-18(27)25-22(19-7-3-2-4-8-19)15-23(28)24-16-20-9-5-6-10-21(20)17-26-11-13-29-14-12-26/h2-10,22H,11-17H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | UDEXLVYDHIHJNZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |