C23H33N3O3 — CID 78810882
N-[1-(4-butan-2-ylphenyl)-2-methylpropyl]-2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 78810882) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-[1-(4-butan-2-ylphenyl)-2-methylpropyl]-2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[1-(4-butan-2-ylphenyl)-2-methylpropyl]-2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 78810882 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | N-[1-(4-butan-2-ylphenyl)-2-methylpropyl]-2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CCC(C)c1ccc(C(NC(=O)CN2C(=O)NC(C)(C3CC3)C2=O)C(C)C)cc1 |
| InChI | InChI=1S/C23H33N3O3/c1-6-15(4)16-7-9-17(10-8-16)20(14(2)3)24-19(27)13-26-21(28)23(5,18-11-12-18)25-22(26)29/h7-10,14-15,18,20H,6,11-13H2,1-5H3,(H,24,27)(H,25,29) |
| InChIKey | BMSPYXXONYWGTJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|