C20H21N3OS — CID 78811718
N-(4-butylphenyl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 78811718) has the molecular formula C20H21N3OS and a molecular weight of 351.48 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(4-butylphenyl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 78811718 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-(4-butylphenyl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | CCCCc1ccc(NC(=O)Cc2csc(-c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C20H21N3OS/c1-2-3-5-15-7-9-17(10-8-15)22-19(24)12-18-14-25-20(23-18)16-6-4-11-21-13-16/h4,6-11,13-14H,2-3,5,12H2,1H3,(H,22,24) |
| InChIKey | QIFPXZUPHYVRKW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |