C21H25N3O3S — CID 78812330
4-ethyl-3-[3-(4-methoxyphenoxy)propylsulfanyl]-5-(2-methoxyphenyl)-1,2,4-triazole (PubChem CID 78812330) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is 4-ethyl-3-[3-(4-methoxyphenoxy)propylsulfanyl]-5-(2-methoxyphenyl)-1,2,4-triazole.
| Compound Name | 4-ethyl-3-[3-(4-methoxyphenoxy)propylsulfanyl]-5-(2-methoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 78812330 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 4-ethyl-3-[3-(4-methoxyphenoxy)propylsulfanyl]-5-(2-methoxyphenyl)-1,2,4-triazole |
| SMILES | CCn1c(SCCCOc2ccc(OC)cc2)nnc1-c1ccccc1OC |
| InChI | InChI=1S/C21H25N3O3S/c1-4-24-20(18-8-5-6-9-19(18)26-3)22-23-21(24)28-15-7-14-27-17-12-10-16(25-2)11-13-17/h5-6,8-13H,4,7,14-15H2,1-3H3 |
| InChIKey | PEHRMCZERNXTBH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|