C15H15F2N3O4 — CID 78813477
N'-[2-(difluoromethoxy)-3-methoxybenzoyl]-1-methylpyrrole-2-carbohydrazide (PubChem CID 78813477) has the molecular formula C15H15F2N3O4 and a molecular weight of 339.30 g/mol. Its IUPAC name is N'-[2-(difluoromethoxy)-3-methoxybenzoyl]-1-methylpyrrole-2-carbohydrazide.
| Compound Name | N'-[2-(difluoromethoxy)-3-methoxybenzoyl]-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78813477 |
| Molecular Formula | C15H15F2N3O4 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N'-[2-(difluoromethoxy)-3-methoxybenzoyl]-1-methylpyrrole-2-carbohydrazide |
| SMILES | COc1cccc(C(=O)NNC(=O)c2cccn2C)c1OC(F)F |
| InChI | InChI=1S/C15H15F2N3O4/c1-20-8-4-6-10(20)14(22)19-18-13(21)9-5-3-7-11(23-2)12(9)24-15(16)17/h3-8,15H,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | ZNITZOZHCJEDJS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|