C23H24N8O — CID 78814768
4-ethyl-1-[[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 78814768) has the molecular formula C23H24N8O and a molecular weight of 428.50 g/mol. Its IUPAC name is 4-ethyl-1-[[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 4-ethyl-1-[[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 78814768 |
| Molecular Formula | C23H24N8O |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 4-ethyl-1-[[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | CCn1c(=O)c2ccccc2n2c(CN3CCC(c4nnc5ccccn45)CC3)nnc12 |
| InChI | InChI=1S/C23H24N8O/c1-2-29-22(32)17-7-3-4-8-18(17)31-20(25-27-23(29)31)15-28-13-10-16(11-14-28)21-26-24-19-9-5-6-12-30(19)21/h3-9,12,16H,2,10-11,13-15H2,1H3 |
| InChIKey | MONPLSXBNPSLPR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |