C18H14BrF2NO3 — CID 7881494
[2-(2,6-difluoroanilino)-2-oxoethyl] (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate (PubChem CID 7881494) has the molecular formula C18H14BrF2NO3 and a molecular weight of 410.21 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7881494 |
| Molecular Formula | C18H14BrF2NO3 |
| Molecular Weight | 410.21 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)OCC(=O)Nc2c(F)cccc2F)c(Br)c1 |
| InChI | InChI=1S/C18H14BrF2NO3/c1-11-5-6-12(13(19)9-11)7-8-17(24)25-10-16(23)22-18-14(20)3-2-4-15(18)21/h2-9H,10H2,1H3,(H,22,23)/b8-7+ |
| InChIKey | NNIZVQHNVPZIFD-BQYQJAHWSA-N |
| XLogP | 4.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.21 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|