C16H21FN4OS — CID 78815147
2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-hexylacetamide (PubChem CID 78815147) has the molecular formula C16H21FN4OS and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-hexylacetamide.
| Compound Name | 2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-hexylacetamide |
|---|---|
| PubChem CID | 78815147 |
| Molecular Formula | C16H21FN4OS |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-hexylacetamide |
| SMILES | CCCCCCNC(=O)CSc1n[nH]c(-c2ccccc2F)n1 |
| InChI | InChI=1S/C16H21FN4OS/c1-2-3-4-7-10-18-14(22)11-23-16-19-15(20-21-16)12-8-5-6-9-13(12)17/h5-6,8-9H,2-4,7,10-11H2,1H3,(H,18,22)(H,19,20,21) |
| InChIKey | HVFAFLIIBCCUDU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|