C18H20N4O — CID 78815389
2-(naphthalen-1-ylamino)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 78815389) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(naphthalen-1-ylamino)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | 2-(naphthalen-1-ylamino)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 78815389 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-(naphthalen-1-ylamino)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | Cc1nn(C)c(C)c1NC(=O)CNc1cccc2ccccc12 |
| InChI | InChI=1S/C18H20N4O/c1-12-18(13(2)22(3)21-12)20-17(23)11-19-16-10-6-8-14-7-4-5-9-15(14)16/h4-10,19H,11H2,1-3H3,(H,20,23) |
| InChIKey | PIYOWIDXCVNBMS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |