C18H29N3O2 — CID 78815634
2-[4-(2-ethoxyphenyl)piperazin-1-yl]-N-methyl-N-propan-2-ylacetamide (PubChem CID 78815634) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 2-[4-(2-ethoxyphenyl)piperazin-1-yl]-N-methyl-N-propan-2-ylacetamide.
| Compound Name | 2-[4-(2-ethoxyphenyl)piperazin-1-yl]-N-methyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 78815634 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 2-[4-(2-ethoxyphenyl)piperazin-1-yl]-N-methyl-N-propan-2-ylacetamide |
| SMILES | CCOc1ccccc1N1CCN(CC(=O)N(C)C(C)C)CC1 |
| InChI | InChI=1S/C18H29N3O2/c1-5-23-17-9-7-6-8-16(17)21-12-10-20(11-13-21)14-18(22)19(4)15(2)3/h6-9,15H,5,10-14H2,1-4H3 |
| InChIKey | PLICDTIJUDXPGT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |