C18H22FNO — CID 78816669
N-[(3-fluorophenyl)methyl]-3-(1-phenylethoxy)propan-1-amine (PubChem CID 78816669) has the molecular formula C18H22FNO and a molecular weight of 287.38 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-3-(1-phenylethoxy)propan-1-amine.
| Compound Name | N-[(3-fluorophenyl)methyl]-3-(1-phenylethoxy)propan-1-amine |
|---|---|
| PubChem CID | 78816669 |
| Molecular Formula | C18H22FNO |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-3-(1-phenylethoxy)propan-1-amine |
| SMILES | CC(OCCCNCc1cccc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C18H22FNO/c1-15(17-8-3-2-4-9-17)21-12-6-11-20-14-16-7-5-10-18(19)13-16/h2-5,7-10,13,15,20H,6,11-12,14H2,1H3 |
| InChIKey | ORSWRECMJIZHBL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|