C13H16N2O3 — CID 78816876
N-(2-hydroxyethyl)-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 78816876) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-3-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-(2-hydroxyethyl)-3-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 78816876 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-(2-hydroxyethyl)-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(NCCO)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C13H16N2O3/c16-8-6-14-13(18)10-3-1-4-11(9-10)15-7-2-5-12(15)17/h1,3-4,9,16H,2,5-8H2,(H,14,18) |
| InChIKey | HJNXIGLITKEZBB-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |