C20H18ClN3O2S2 — CID 78817586
2-chloro-N'-[2-(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetyl]benzohydrazide (PubChem CID 78817586) has the molecular formula C20H18ClN3O2S2 and a molecular weight of 431.97 g/mol. Its IUPAC name is 2-chloro-N'-[2-(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[2-(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 78817586 |
| Molecular Formula | C20H18ClN3O2S2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 2-chloro-N'-[2-(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetyl]benzohydrazide |
| SMILES | O=C(CN1CCc2sccc2C1c1cccs1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H18ClN3O2S2/c21-15-5-2-1-4-13(15)20(26)23-22-18(25)12-24-9-7-16-14(8-11-28-16)19(24)17-6-3-10-27-17/h1-6,8,10-11,19H,7,9,12H2,(H,22,25)(H,23,26) |
| InChIKey | ASYZHUZVSKGTFA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|