C12H5Cl4N3O3 — CID 78817742
4,5,6,7-tetrachloro-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]isoindole-1,3-dione (PubChem CID 78817742) has the molecular formula C12H5Cl4N3O3 and a molecular weight of 381.00 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 78817742 |
| Molecular Formula | C12H5Cl4N3O3 |
| Molecular Weight | 381.00 g/mol |
| Exact Mass | 378.91 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]isoindole-1,3-dione |
| SMILES | Cc1nnc(CN2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)o1 |
| InChI | InChI=1S/C12H5Cl4N3O3/c1-3-17-18-4(22-3)2-19-11(20)5-6(12(19)21)8(14)10(16)9(15)7(5)13/h2H2,1H3 |
| InChIKey | HQGWPVOSVABRNS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.00 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|