C24H29N5O2 — CID 78818674
N-ethyl-4-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]piperazine-1-carboxamide (PubChem CID 78818674) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-ethyl-4-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]piperazine-1-carboxamide.
| Compound Name | N-ethyl-4-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 78818674 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-ethyl-4-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]piperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(Cc2cn(-c3ccccc3)nc2-c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C24H29N5O2/c1-3-25-24(30)28-15-13-27(14-16-28)17-20-18-29(21-7-5-4-6-8-21)26-23(20)19-9-11-22(31-2)12-10-19/h4-12,18H,3,13-17H2,1-2H3,(H,25,30) |
| InChIKey | ZPAYJPWYUZWFCF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |