C14H14N4OS — CID 78818873
N-[2-(1,3-benzothiazol-2-yl)ethyl]-4-methoxypyrimidin-2-amine (PubChem CID 78818873) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)ethyl]-4-methoxypyrimidin-2-amine.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-4-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 78818873 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-4-methoxypyrimidin-2-amine |
| SMILES | COc1ccnc(NCCc2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C14H14N4OS/c1-19-12-6-8-15-14(18-12)16-9-7-13-17-10-4-2-3-5-11(10)20-13/h2-6,8H,7,9H2,1H3,(H,15,16,18) |
| InChIKey | DREFTXWRSPPNAZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |