About (4-methyl-1,4-diazepan-1-yl)-(2,4,5-trimethylfuran-3-yl)methanone
(4-methyl-1,4-diazepan-1-yl)-(2,4,5-trimethylfuran-3-yl)methanone (PubChem CID 78819111) has the molecular formula C14H22N2O2
and a molecular weight of 250.34 g/mol. Its IUPAC name is (4-methyl-1,4-diazepan-1-yl)-(2,4,5-trimethylfuran-3-yl)methanone.
Molecular Properties
| Compound Name | (4-methyl-1,4-diazepan-1-yl)-(2,4,5-trimethylfuran-3-yl)methanone |
| PubChem CID | 78819111 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (4-methyl-1,4-diazepan-1-yl)-(2,4,5-trimethylfuran-3-yl)methanone |
| SMILES | Cc1oc(C)c(C(=O)N2CCCN(C)CC2)c1C |
| InChI | InChI=1S/C14H22N2O2/c1-10-11(2)18-12(3)13(10)14(17)16-7-5-6-15(4)8-9-16/h5-9H2,1-4H3 |
| InChIKey | ONFXCOYTEZBSML-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methyl-1,4-diazepan-1-yl)-(2,4,5-trimethylfuran-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-1,4-diazepan-1-yl)-(2,4,5-trimethylfuran-3-yl)methanone?
The IUPAC name of (4-methyl-1,4-diazepan-1-yl)-(2,4,5-trimethylfuran-3-yl)methanone (CID 78819111) is (4-methyl-1,4-diazepan-1-yl)-(2,4,5-trimethylfuran-3-yl)methanone.
What is the SMILES notation for (4-methyl-1,4-diazepan-1-yl)-(2,4,5-trimethylfuran-3-yl)methanone?
The canonical SMILES for (4-methyl-1,4-diazepan-1-yl)-(2,4,5-trimethylfuran-3-yl)methanone is Cc1oc(C)c(C(=O)N2CCCN(C)CC2)c1C.
What is the InChIKey of (4-methyl-1,4-diazepan-1-yl)-(2,4,5-trimethylfuran-3-yl)methanone?
The InChIKey is ONFXCOYTEZBSML-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2/c1-10-11(2)18-12(3)13(10)14(17)16-7-5-6-15(4)8-9-16/h5-9H2,1-4H3.
What are the key properties of (4-methyl-1,4-diazepan-1-yl)-(2,4,5-trimethylfuran-3-yl)methanone?
(4-methyl-1,4-diazepan-1-yl)-(2,4,5-trimethylfuran-3-yl)methanone has a molecular weight of 250.34 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1,4-diazepan-1-yl)-(2,4,5-trimethylfuran-3-yl)methanone is sourced from PubChem (CID 78819111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).