C22H28N2O4S — CID 78819601
N-[3-(dimethylamino)propyl]-N-(1,1-dioxothiolan-3-yl)-4-phenoxybenzamide (PubChem CID 78819601) has the molecular formula C22H28N2O4S and a molecular weight of 416.54 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-(1,1-dioxothiolan-3-yl)-4-phenoxybenzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-(1,1-dioxothiolan-3-yl)-4-phenoxybenzamide |
|---|---|
| PubChem CID | 78819601 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-(1,1-dioxothiolan-3-yl)-4-phenoxybenzamide |
| SMILES | CN(C)CCCN(C(=O)c1ccc(Oc2ccccc2)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H28N2O4S/c1-23(2)14-6-15-24(19-13-16-29(26,27)17-19)22(25)18-9-11-21(12-10-18)28-20-7-4-3-5-8-20/h3-5,7-12,19H,6,13-17H2,1-2H3 |
| InChIKey | LPEBUPOACIYZKO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |