C15H12BrFN2O3 — CID 78820007
4-(2-amino-2-oxoethoxy)-N-(4-bromo-2-fluorophenyl)benzamide (PubChem CID 78820007) has the molecular formula C15H12BrFN2O3 and a molecular weight of 367.17 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-(4-bromo-2-fluorophenyl)benzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-(4-bromo-2-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 78820007 |
| Molecular Formula | C15H12BrFN2O3 |
| Molecular Weight | 367.17 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-(4-bromo-2-fluorophenyl)benzamide |
| SMILES | NC(=O)COc1ccc(C(=O)Nc2ccc(Br)cc2F)cc1 |
| InChI | InChI=1S/C15H12BrFN2O3/c16-10-3-6-13(12(17)7-10)19-15(21)9-1-4-11(5-2-9)22-8-14(18)20/h1-7H,8H2,(H2,18,20)(H,19,21) |
| InChIKey | PUGPYYRMOYIYFX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.17 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |