C13H8F2N4OS — CID 78820192
(3E)-2-amino-4-[5-(difluoromethylsulfanylmethyl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 78820192) has the molecular formula C13H8F2N4OS and a molecular weight of 306.30 g/mol. Its IUPAC name is (3E)-2-amino-4-[5-(difluoromethylsulfanylmethyl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile.
| Compound Name | (3E)-2-amino-4-[5-(difluoromethylsulfanylmethyl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 78820192 |
| Molecular Formula | C13H8F2N4OS |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (3E)-2-amino-4-[5-(difluoromethylsulfanylmethyl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | N#CC(C#N)=C(N)/C(C#N)=C\c1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C13H8F2N4OS/c14-13(15)21-7-11-2-1-10(20-11)3-8(4-16)12(19)9(5-17)6-18/h1-3,13H,7,19H2/b8-3- |
| InChIKey | NWWLBBCRRQBQMD-BAQGIRSFSA-N |
| XLogP | 2.90 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|