About 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]pentanamide
3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]pentanamide (PubChem CID 78820356) has the molecular formula C12H22N4O3S
and a molecular weight of 302.40 g/mol. Its IUPAC name is 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]pentanamide.
Molecular Properties
| Compound Name | 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]pentanamide |
| PubChem CID | 78820356 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]pentanamide |
| SMILES | CCC(C)C(NS(=O)(=O)c1c(C)nn(C)c1C)C(N)=O |
| InChI | InChI=1S/C12H22N4O3S/c1-6-7(2)10(12(13)17)15-20(18,19)11-8(3)14-16(5)9(11)4/h7,10,15H,6H2,1-5H3,(H2,13,17) |
| InChIKey | NDRAEQSKIVOQIU-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]pentanamide?
The IUPAC name of 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]pentanamide (CID 78820356) is 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]pentanamide.
What is the SMILES notation for 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]pentanamide?
The canonical SMILES for 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]pentanamide is CCC(C)C(NS(=O)(=O)c1c(C)nn(C)c1C)C(N)=O.
What is the InChIKey of 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]pentanamide?
The InChIKey is NDRAEQSKIVOQIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O3S/c1-6-7(2)10(12(13)17)15-20(18,19)11-8(3)14-16(5)9(11)4/h7,10,15H,6H2,1-5H3,(H2,13,17).
What are the key properties of 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]pentanamide?
3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]pentanamide has a molecular weight of 302.40 g/mol, XLogP of 0.22, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]pentanamide is sourced from PubChem (CID 78820356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).