About N-[3-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide
N-[3-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 78820404) has the molecular formula C20H18N2O4S
and a molecular weight of 382.44 g/mol. Its IUPAC name is N-[3-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide |
| PubChem CID | 78820404 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[3-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCc1ccc(O)c(O)c1)c1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C20H18N2O4S/c23-16-7-6-13(11-17(16)24)8-9-21-19(25)14-3-1-4-15(12-14)22-20(26)18-5-2-10-27-18/h1-7,10-12,23-24H,8-9H2,(H,21,25)(H,22,26) |
| InChIKey | LRNZJXDACDGKGM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide?
The IUPAC name of N-[3-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide (CID 78820404) is N-[3-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide.
What is the SMILES notation for N-[3-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide?
The canonical SMILES for N-[3-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide is O=C(NCCc1ccc(O)c(O)c1)c1cccc(NC(=O)c2cccs2)c1.
What is the InChIKey of N-[3-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide?
The InChIKey is LRNZJXDACDGKGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O4S/c23-16-7-6-13(11-17(16)24)8-9-21-19(25)14-3-1-4-15(12-14)22-20(26)18-5-2-10-27-18/h1-7,10-12,23-24H,8-9H2,(H,21,25)(H,22,26).
What are the key properties of N-[3-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide?
N-[3-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide has a molecular weight of 382.44 g/mol, XLogP of 3.38, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide is sourced from PubChem (CID 78820404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).